C9H20NO2+ — CID 144656148
(2S)-1,1-dimethylpyrrolidin-1-ium-2-carboxylic acid;ethane (PubChem CID 144656148) has the molecular formula C9H20NO2+ and a molecular weight of 174.26 g/mol. Its IUPAC name is (2S)-1,1-dimethylpyrrolidin-1-ium-2-carboxylic acid;ethane.
| Compound Name | (2S)-1,1-dimethylpyrrolidin-1-ium-2-carboxylic acid;ethane |
|---|---|
| PubChem CID | 144656148 |
| Molecular Formula | C9H20NO2+ |
| Molecular Weight | 174.26 g/mol |
| Exact Mass | 174.15 |
| IUPAC Name | (2S)-1,1-dimethylpyrrolidin-1-ium-2-carboxylic acid;ethane |
| SMILES | CC.C[N+]1(C)CCC[C@H]1C(=O)O |
| InChI | InChI=1S/C7H13NO2.C2H6/c1-8(2)5-3-4-6(8)7(9)10;1-2/h6H,3-5H2,1-2H3;1-2H3/p+1/t6-;/m0./s1 |
| InChIKey | CCFXEIKZIKXVNA-RGMNGODLSA-O |
| XLogP | 1.34 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.26 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|