C11H17N2O+ — CID 123851329
1,1-dimethyl-N-prop-2-ynylidenepiperidin-1-ium-2-carboxamide (PubChem CID 123851329) has the molecular formula C11H17N2O+ and a molecular weight of 193.27 g/mol. Its IUPAC name is 1,1-dimethyl-N-prop-2-ynylidenepiperidin-1-ium-2-carboxamide.
| Compound Name | 1,1-dimethyl-N-prop-2-ynylidenepiperidin-1-ium-2-carboxamide |
|---|---|
| PubChem CID | 123851329 |
| Molecular Formula | C11H17N2O+ |
| Molecular Weight | 193.27 g/mol |
| Exact Mass | 193.13 |
| IUPAC Name | 1,1-dimethyl-N-prop-2-ynylidenepiperidin-1-ium-2-carboxamide |
| SMILES | C#C/C=N/C(=O)C1CCCC[N+]1(C)C |
| InChI | InChI=1S/C11H17N2O/c1-4-8-12-11(14)10-7-5-6-9-13(10,2)3/h1,8,10H,5-7,9H2,2-3H3/q+1/b12-8+ |
| InChIKey | UPDRICZZWDAOIA-XYOKQWHBSA-N |
| XLogP | 0.85 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.27 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|