C8H19ClNO3P — CID 67848323
(1,1-dimethylpiperidin-1-ium-2-yl)methylphosphonic acid chloride (PubChem CID 67848323) has the molecular formula C8H19ClNO3P and a molecular weight of 243.67 g/mol. Its IUPAC name is (1,1-dimethylpiperidin-1-ium-2-yl)methylphosphonic acid chloride.
| Compound Name | (1,1-dimethylpiperidin-1-ium-2-yl)methylphosphonic acid chloride |
|---|---|
| PubChem CID | 67848323 |
| Molecular Formula | C8H19ClNO3P |
| Molecular Weight | 243.67 g/mol |
| Exact Mass | 243.08 |
| IUPAC Name | (1,1-dimethylpiperidin-1-ium-2-yl)methylphosphonic acid chloride |
| SMILES | C[N+]1(C)CCCCC1CP(=O)(O)O.[Cl-] |
| InChI | InChI=1S/C8H18NO3P.ClH/c1-9(2)6-4-3-5-8(9)7-13(10,11)12;/h8H,3-7H2,1-2H3,(H-,10,11,12);1H |
| InChIKey | TXUGPMVFXBVWND-UHFFFAOYSA-N |
| XLogP | -2.20 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.67 |
| LogP ≤ 5 | -2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|