C21H28NO+ — CID 146188961
2-[2-(1,1-dimethylpiperidin-1-ium-2-yl)-1-phenylethyl]phenol (PubChem CID 146188961) has the molecular formula C21H28NO+ and a molecular weight of 310.46 g/mol. Its IUPAC name is 2-[2-(1,1-dimethylpiperidin-1-ium-2-yl)-1-phenylethyl]phenol.
| Compound Name | 2-[2-(1,1-dimethylpiperidin-1-ium-2-yl)-1-phenylethyl]phenol |
|---|---|
| PubChem CID | 146188961 |
| Molecular Formula | C21H28NO+ |
| Molecular Weight | 310.46 g/mol |
| Exact Mass | 310.22 |
| IUPAC Name | 2-[2-(1,1-dimethylpiperidin-1-ium-2-yl)-1-phenylethyl]phenol |
| SMILES | C[N+]1(C)CCCCC1CC(c1ccccc1)c1ccccc1O |
| InChI | InChI=1S/C21H27NO/c1-22(2)15-9-8-12-18(22)16-20(17-10-4-3-5-11-17)19-13-6-7-14-21(19)23/h3-7,10-11,13-14,18,20H,8-9,12,15-16H2,1-2H3/p+1 |
| InChIKey | MHNKGXTWTRTTLW-UHFFFAOYSA-O |
| XLogP | 4.54 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.46 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|