C26H36NO2+ — CID 156687158
[2-[2-(1,1-dimethylpiperidin-1-ium-2-yl)-1-phenylethyl]-4-methylphenyl] 2-methylpropanoate (PubChem CID 156687158) has the molecular formula C26H36NO2+ and a molecular weight of 394.58 g/mol. Its IUPAC name is [2-[2-(1,1-dimethylpiperidin-1-ium-2-yl)-1-phenylethyl]-4-methylphenyl] 2-methylpropanoate.
| Compound Name | [2-[2-(1,1-dimethylpiperidin-1-ium-2-yl)-1-phenylethyl]-4-methylphenyl] 2-methylpropanoate |
|---|---|
| PubChem CID | 156687158 |
| Molecular Formula | C26H36NO2+ |
| Molecular Weight | 394.58 g/mol |
| Exact Mass | 394.27 |
| IUPAC Name | [2-[2-(1,1-dimethylpiperidin-1-ium-2-yl)-1-phenylethyl]-4-methylphenyl] 2-methylpropanoate |
| SMILES | Cc1ccc(OC(=O)C(C)C)c(C(CC2CCCC[N+]2(C)C)c2ccccc2)c1 |
| InChI | InChI=1S/C26H36NO2/c1-19(2)26(28)29-25-15-14-20(3)17-24(25)23(21-11-7-6-8-12-21)18-22-13-9-10-16-27(22,4)5/h6-8,11-12,14-15,17,19,22-23H,9-10,13,16,18H2,1-5H3/q+1 |
| InChIKey | SSGQWLUFXWKEFX-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.58 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|