C22H30BrNO — CID 3047852
1,1-dimethyl-2-[[(4-methylphenyl)-phenylmethoxy]methyl]piperidin-1-ium bromide (PubChem CID 3047852) has the molecular formula C22H30BrNO and a molecular weight of 404.39 g/mol. Its IUPAC name is 1,1-dimethyl-2-[[(4-methylphenyl)-phenylmethoxy]methyl]piperidin-1-ium bromide.
| Compound Name | 1,1-dimethyl-2-[[(4-methylphenyl)-phenylmethoxy]methyl]piperidin-1-ium bromide |
|---|---|
| PubChem CID | 3047852 |
| Molecular Formula | C22H30BrNO |
| Molecular Weight | 404.39 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | 1,1-dimethyl-2-[[(4-methylphenyl)-phenylmethoxy]methyl]piperidin-1-ium bromide |
| SMILES | Cc1ccc(C(OCC2CCCC[N+]2(C)C)c2ccccc2)cc1.[Br-] |
| InChI | InChI=1S/C22H30NO.BrH/c1-18-12-14-20(15-13-18)22(19-9-5-4-6-10-19)24-17-21-11-7-8-16-23(21,2)3;/h4-6,9-10,12-15,21-22H,7-8,11,16-17H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | DJJOASJXEODSJF-UHFFFAOYSA-M |
| XLogP | 1.73 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.39 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|