C18H19FO — CID 123624962
4-[cyclopropylmethoxy(phenyl)methyl]-1-fluoro-2-methylbenzene (PubChem CID 123624962) has the molecular formula C18H19FO and a molecular weight of 270.35 g/mol. Its IUPAC name is 4-[cyclopropylmethoxy(phenyl)methyl]-1-fluoro-2-methylbenzene.
| Compound Name | 4-[cyclopropylmethoxy(phenyl)methyl]-1-fluoro-2-methylbenzene |
|---|---|
| PubChem CID | 123624962 |
| Molecular Formula | C18H19FO |
| Molecular Weight | 270.35 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | 4-[cyclopropylmethoxy(phenyl)methyl]-1-fluoro-2-methylbenzene |
| SMILES | Cc1cc(C(OCC2CC2)c2ccccc2)ccc1F |
| InChI | InChI=1S/C18H19FO/c1-13-11-16(9-10-17(13)19)18(20-12-14-7-8-14)15-5-3-2-4-6-15/h2-6,9-11,14,18H,7-8,12H2,1H3 |
| InChIKey | DVKCQDWCWBXANV-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.35 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |