C19H26NO+ — CID 7745828
2-[(S)-(3,4-dimethylphenyl)-phenylmethoxy]ethyl-dimethylazanium (PubChem CID 7745828) has the molecular formula C19H26NO+ and a molecular weight of 284.42 g/mol. Its IUPAC name is 2-[(S)-(3,4-dimethylphenyl)-phenylmethoxy]ethyl-dimethylazanium.
| Compound Name | 2-[(S)-(3,4-dimethylphenyl)-phenylmethoxy]ethyl-dimethylazanium |
|---|---|
| PubChem CID | 7745828 |
| Molecular Formula | C19H26NO+ |
| Molecular Weight | 284.42 g/mol |
| Exact Mass | 284.20 |
| IUPAC Name | 2-[(S)-(3,4-dimethylphenyl)-phenylmethoxy]ethyl-dimethylazanium |
| SMILES | Cc1ccc([C@@H](OCC[NH+](C)C)c2ccccc2)cc1C |
| InChI | InChI=1S/C19H25NO/c1-15-10-11-18(14-16(15)2)19(21-13-12-20(3)4)17-8-6-5-7-9-17/h5-11,14,19H,12-13H2,1-4H3/p+1/t19-/m0/s1 |
| InChIKey | FYMARQDOVPCXLS-IBGZPJMESA-O |
| XLogP | 2.55 |
| TPSA | 13.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.42 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |