C25H31NO5 — CID 70591601
(Z)-but-2-enedioic acid;1-methyl-2-[[(4-methylphenyl)-phenylmethoxy]methyl]piperidine (PubChem CID 70591601) has the molecular formula C25H31NO5 and a molecular weight of 425.53 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;1-methyl-2-[[(4-methylphenyl)-phenylmethoxy]methyl]piperidine.
| Compound Name | (Z)-but-2-enedioic acid;1-methyl-2-[[(4-methylphenyl)-phenylmethoxy]methyl]piperidine |
|---|---|
| PubChem CID | 70591601 |
| Molecular Formula | C25H31NO5 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.22 |
| IUPAC Name | (Z)-but-2-enedioic acid;1-methyl-2-[[(4-methylphenyl)-phenylmethoxy]methyl]piperidine |
| SMILES | Cc1ccc(C(OCC2CCCCN2C)c2ccccc2)cc1.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C21H27NO.C4H4O4/c1-17-11-13-19(14-12-17)21(18-8-4-3-5-9-18)23-16-20-10-6-7-15-22(20)2;5-3(6)1-2-4(7)8/h3-5,8-9,11-14,20-21H,6-7,10,15-16H2,1-2H3;1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | GAEHOEFQCBMINC-BTJKTKAUSA-N |
| XLogP | 4.30 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|