C10H24NO6P2S+ — CID 23193191
[2-[1-methyl-1-(2-sulfanylethyl)piperidin-1-ium-2-yl]-1-phosphonoethyl]phosphonic acid (PubChem CID 23193191) has the molecular formula C10H24NO6P2S+ and a molecular weight of 348.32 g/mol. Its IUPAC name is [2-[1-methyl-1-(2-sulfanylethyl)piperidin-1-ium-2-yl]-1-phosphonoethyl]phosphonic acid.
| Compound Name | [2-[1-methyl-1-(2-sulfanylethyl)piperidin-1-ium-2-yl]-1-phosphonoethyl]phosphonic acid |
|---|---|
| PubChem CID | 23193191 |
| Molecular Formula | C10H24NO6P2S+ |
| Molecular Weight | 348.32 g/mol |
| Exact Mass | 348.08 |
| IUPAC Name | [2-[1-methyl-1-(2-sulfanylethyl)piperidin-1-ium-2-yl]-1-phosphonoethyl]phosphonic acid |
| SMILES | C[N+]1(CCS)CCCCC1CC(P(=O)(O)O)P(=O)(O)O |
| InChI | InChI=1S/C10H23NO6P2S/c1-11(6-7-20)5-3-2-4-9(11)8-10(18(12,13)14)19(15,16)17/h9-10H,2-8H2,1H3,(H4-,12,13,14,15,16,17,20)/p+1 |
| InChIKey | OWFJYBGUUAHGQM-UHFFFAOYSA-O |
| XLogP | 0.99 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.32 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|