About 2-cyclohexyloxyethyl 2-(1-methylpiperidin-1-ium-1-yl)ethyl hydrogen phosphate
2-cyclohexyloxyethyl 2-(1-methylpiperidin-1-ium-1-yl)ethyl hydrogen phosphate (PubChem CID 11035471) has the molecular formula C16H33NO5P+
and a molecular weight of 350.42 g/mol. Its IUPAC name is 2-cyclohexyloxyethyl 2-(1-methylpiperidin-1-ium-1-yl)ethyl hydrogen phosphate.
Molecular Properties
| Compound Name | 2-cyclohexyloxyethyl 2-(1-methylpiperidin-1-ium-1-yl)ethyl hydrogen phosphate |
| PubChem CID | 11035471 |
| Molecular Formula | C16H33NO5P+ |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | 2-cyclohexyloxyethyl 2-(1-methylpiperidin-1-ium-1-yl)ethyl hydrogen phosphate |
| SMILES | C[N+]1(CCOP(=O)(O)OCCOC2CCCCC2)CCCCC1 |
| InChI | InChI=1S/C16H32NO5P/c1-17(10-6-3-7-11-17)12-13-21-23(18,19)22-15-14-20-16-8-4-2-5-9-16/h16H,2-15H2,1H3/p+1 |
| InChIKey | WZEJBZYAVWRNJI-UHFFFAOYSA-O |
| XLogP | 3.10 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 2-cyclohexyloxyethyl 2-(1-methylpiperidin-1-ium-1-yl)ethyl hydrogen phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclohexyloxyethyl 2-(1-methylpiperidin-1-ium-1-yl)ethyl hydrogen phosphate?
The IUPAC name of 2-cyclohexyloxyethyl 2-(1-methylpiperidin-1-ium-1-yl)ethyl hydrogen phosphate (CID 11035471) is 2-cyclohexyloxyethyl 2-(1-methylpiperidin-1-ium-1-yl)ethyl hydrogen phosphate.
What is the SMILES notation for 2-cyclohexyloxyethyl 2-(1-methylpiperidin-1-ium-1-yl)ethyl hydrogen phosphate?
The canonical SMILES for 2-cyclohexyloxyethyl 2-(1-methylpiperidin-1-ium-1-yl)ethyl hydrogen phosphate is C[N+]1(CCOP(=O)(O)OCCOC2CCCCC2)CCCCC1.
What is the InChIKey of 2-cyclohexyloxyethyl 2-(1-methylpiperidin-1-ium-1-yl)ethyl hydrogen phosphate?
The InChIKey is WZEJBZYAVWRNJI-UHFFFAOYSA-O. The full InChI is InChI=1S/C16H32NO5P/c1-17(10-6-3-7-11-17)12-13-21-23(18,19)22-15-14-20-16-8-4-2-5-9-16/h16H,2-15H2,1H3/p+1.
What are the key properties of 2-cyclohexyloxyethyl 2-(1-methylpiperidin-1-ium-1-yl)ethyl hydrogen phosphate?
2-cyclohexyloxyethyl 2-(1-methylpiperidin-1-ium-1-yl)ethyl hydrogen phosphate has a molecular weight of 350.42 g/mol, XLogP of 3.10, 9 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclohexyloxyethyl 2-(1-methylpiperidin-1-ium-1-yl)ethyl hydrogen phosphate is sourced from PubChem (CID 11035471), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).