About ethyl (1-methylpiperidin-1-ium-1-yl)methyl hydrogen phosphate
ethyl (1-methylpiperidin-1-ium-1-yl)methyl hydrogen phosphate (PubChem CID 134215317) has the molecular formula C9H21NO4P+
and a molecular weight of 238.24 g/mol. Its IUPAC name is ethyl (1-methylpiperidin-1-ium-1-yl)methyl hydrogen phosphate.
Molecular Properties
| Compound Name | ethyl (1-methylpiperidin-1-ium-1-yl)methyl hydrogen phosphate |
| PubChem CID | 134215317 |
| Molecular Formula | C9H21NO4P+ |
| Molecular Weight | 238.24 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | ethyl (1-methylpiperidin-1-ium-1-yl)methyl hydrogen phosphate |
| SMILES | CCOP(=O)(O)OC[N+]1(C)CCCCC1 |
| InChI | InChI=1S/C9H20NO4P/c1-3-13-15(11,12)14-9-10(2)7-5-4-6-8-10/h3-9H2,1-2H3/p+1 |
| InChIKey | DFVMEIRFMNLSJP-UHFFFAOYSA-O |
| XLogP | 1.73 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.24 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze ethyl (1-methylpiperidin-1-ium-1-yl)methyl hydrogen phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (1-methylpiperidin-1-ium-1-yl)methyl hydrogen phosphate?
The IUPAC name of ethyl (1-methylpiperidin-1-ium-1-yl)methyl hydrogen phosphate (CID 134215317) is ethyl (1-methylpiperidin-1-ium-1-yl)methyl hydrogen phosphate.
What is the SMILES notation for ethyl (1-methylpiperidin-1-ium-1-yl)methyl hydrogen phosphate?
The canonical SMILES for ethyl (1-methylpiperidin-1-ium-1-yl)methyl hydrogen phosphate is CCOP(=O)(O)OC[N+]1(C)CCCCC1.
What is the InChIKey of ethyl (1-methylpiperidin-1-ium-1-yl)methyl hydrogen phosphate?
The InChIKey is DFVMEIRFMNLSJP-UHFFFAOYSA-O. The full InChI is InChI=1S/C9H20NO4P/c1-3-13-15(11,12)14-9-10(2)7-5-4-6-8-10/h3-9H2,1-2H3/p+1.
What are the key properties of ethyl (1-methylpiperidin-1-ium-1-yl)methyl hydrogen phosphate?
ethyl (1-methylpiperidin-1-ium-1-yl)methyl hydrogen phosphate has a molecular weight of 238.24 g/mol, XLogP of 1.73, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (1-methylpiperidin-1-ium-1-yl)methyl hydrogen phosphate is sourced from PubChem (CID 134215317), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).