C10H24NO6P2+ — CID 23193119
[1-phosphono-2-(1,1,5-trimethylpiperidin-1-ium-2-yl)ethyl]phosphonic acid (PubChem CID 23193119) has the molecular formula C10H24NO6P2+ and a molecular weight of 316.25 g/mol. Its IUPAC name is [1-phosphono-2-(1,1,5-trimethylpiperidin-1-ium-2-yl)ethyl]phosphonic acid.
| Compound Name | [1-phosphono-2-(1,1,5-trimethylpiperidin-1-ium-2-yl)ethyl]phosphonic acid |
|---|---|
| PubChem CID | 23193119 |
| Molecular Formula | C10H24NO6P2+ |
| Molecular Weight | 316.25 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | [1-phosphono-2-(1,1,5-trimethylpiperidin-1-ium-2-yl)ethyl]phosphonic acid |
| SMILES | CC1CCC(CC(P(=O)(O)O)P(=O)(O)O)[N+](C)(C)C1 |
| InChI | InChI=1S/C10H23NO6P2/c1-8-4-5-9(11(2,3)7-8)6-10(18(12,13)14)19(15,16)17/h8-10H,4-7H2,1-3H3,(H3-,12,13,14,15,16,17)/p+1 |
| InChIKey | NWFSYXGUJUOVIF-UHFFFAOYSA-O |
| XLogP | 0.93 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.25 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|