C7H16O7P2 — CID 87165714
(6-hydroxy-1-phosphonohept-5-enyl)phosphonic acid (PubChem CID 87165714) has the molecular formula C7H16O7P2 and a molecular weight of 274.15 g/mol. Its IUPAC name is (6-hydroxy-1-phosphonohept-5-enyl)phosphonic acid.
| Compound Name | (6-hydroxy-1-phosphonohept-5-enyl)phosphonic acid |
|---|---|
| PubChem CID | 87165714 |
| Molecular Formula | C7H16O7P2 |
| Molecular Weight | 274.15 g/mol |
| Exact Mass | 274.04 |
| IUPAC Name | (6-hydroxy-1-phosphonohept-5-enyl)phosphonic acid |
| SMILES | CC(O)=CCCCC(P(=O)(O)O)P(=O)(O)O |
| InChI | InChI=1S/C7H16O7P2/c1-6(8)4-2-3-5-7(15(9,10)11)16(12,13)14/h4,7-8H,2-3,5H2,1H3,(H2,9,10,11)(H2,12,13,14) |
| InChIKey | GQMWAQZZBOTJCH-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 135.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.15 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|