C8H26O24P8 — CID 22146136
[2,2-bis(diphosphonomethyl)-1,6,6-triphosphonohexyl]phosphonic acid (PubChem CID 22146136) has the molecular formula C8H26O24P8 and a molecular weight of 754.06 g/mol. Its IUPAC name is [2,2-bis(diphosphonomethyl)-1,6,6-triphosphonohexyl]phosphonic acid.
| Compound Name | [2,2-bis(diphosphonomethyl)-1,6,6-triphosphonohexyl]phosphonic acid |
|---|---|
| PubChem CID | 22146136 |
| Molecular Formula | C8H26O24P8 |
| Molecular Weight | 754.06 g/mol |
| Exact Mass | 753.87 |
| IUPAC Name | [2,2-bis(diphosphonomethyl)-1,6,6-triphosphonohexyl]phosphonic acid |
| SMILES | O=P(O)(O)C(CCCC(C(P(=O)(O)O)P(=O)(O)O)(C(P(=O)(O)O)P(=O)(O)O)C(P(=O)(O)O)P(=O)(O)O)P(=O)(O)O |
| InChI | InChI=1S/C8H26O24P8/c9-33(10,11)4(34(12,13)14)2-1-3-8(5(35(15,16)17)36(18,19)20,6(37(21,22)23)38(24,25)26)7(39(27,28)29)40(30,31)32/h4-7H,1-3H2,(H2,9,10,11)(H2,12,13,14)(H2,15,16,17)(H2,18,19,20)(H2,21,22,23)(H2,24,25,26)(H2,27,28,29)(H2,30,31,32) |
| InChIKey | UYAWTXVBAIMUJW-UHFFFAOYSA-N |
| XLogP | -2.13 |
| TPSA | 460.24 Ų |
| H-Bond Donors | 16 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 754.06 |
| LogP ≤ 5 | -2.13 |
| H-Bond Donors ≤ 5 | 16 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|