C9H21NO7P2 — CID 157374692
[3-hydroxy-3-(1-methylpiperidin-2-yl)-1-phosphonopropyl]phosphonic acid (PubChem CID 157374692) has the molecular formula C9H21NO7P2 and a molecular weight of 317.22 g/mol. Its IUPAC name is [3-hydroxy-3-(1-methylpiperidin-2-yl)-1-phosphonopropyl]phosphonic acid.
| Compound Name | [3-hydroxy-3-(1-methylpiperidin-2-yl)-1-phosphonopropyl]phosphonic acid |
|---|---|
| PubChem CID | 157374692 |
| Molecular Formula | C9H21NO7P2 |
| Molecular Weight | 317.22 g/mol |
| Exact Mass | 317.08 |
| IUPAC Name | [3-hydroxy-3-(1-methylpiperidin-2-yl)-1-phosphonopropyl]phosphonic acid |
| SMILES | CN1CCCCC1C(O)CC(P(=O)(O)O)P(=O)(O)O |
| InChI | InChI=1S/C9H21NO7P2/c1-10-5-3-2-4-7(10)8(11)6-9(18(12,13)14)19(15,16)17/h7-9,11H,2-6H2,1H3,(H2,12,13,14)(H2,15,16,17) |
| InChIKey | BKEJDVLBPPGRLD-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 138.53 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.22 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|