C6H13NO4SW — CID 59075961
hydroxy-[(2S)-1-methylpyrrolidin-2-yl]methanesulfonic acid;tungsten (PubChem CID 59075961) has the molecular formula C6H13NO4SW and a molecular weight of 379.08 g/mol. Its IUPAC name is hydroxy-[(2S)-1-methylpyrrolidin-2-yl]methanesulfonic acid;tungsten.
| Compound Name | hydroxy-[(2S)-1-methylpyrrolidin-2-yl]methanesulfonic acid;tungsten |
|---|---|
| PubChem CID | 59075961 |
| Molecular Formula | C6H13NO4SW |
| Molecular Weight | 379.08 g/mol |
| Exact Mass | 379.01 |
| IUPAC Name | hydroxy-[(2S)-1-methylpyrrolidin-2-yl]methanesulfonic acid;tungsten |
| SMILES | CN1CCC[C@H]1C(O)S(=O)(=O)O.[W] |
| InChI | InChI=1S/C6H13NO4S.W/c1-7-4-2-3-5(7)6(8)12(9,10)11;/h5-6,8H,2-4H2,1H3,(H,9,10,11);/t5-,6?;/m0./s1 |
| InChIKey | IGWAOEPNNZHHBV-GNVLWMSISA-N |
| XLogP | -0.72 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.08 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|