C6H10BNO5SW — CID 59075953
CID 59075953 (PubChem CID 59075953) has the molecular formula C6H10BNO5SW and a molecular weight of 402.87 g/mol.
| Compound Name | CID 59075953 |
|---|---|
| PubChem CID | 59075953 |
| Molecular Formula | C6H10BNO5SW |
| Molecular Weight | 402.87 g/mol |
| Exact Mass | 402.99 |
| IUPAC Name | — |
| SMILES | [B]C(=O)N1CCC[C@H]1C(O)S(=O)(=O)O.[W] |
| InChI | InChI=1S/C6H10BNO5S.W/c7-6(10)8-3-1-2-4(8)5(9)14(11,12)13;/h4-5,9H,1-3H2,(H,11,12,13);/t4-,5?;/m0./s1 |
| InChIKey | KTKKITHJNZTQSY-PHHGQXFYSA-N |
| XLogP | -1.06 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.87 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|