C7H11N3O — CID 59151521
2-amino-1-[(2R)-2-isocyanopyrrolidin-1-yl]ethanone (PubChem CID 59151521) has the molecular formula C7H11N3O and a molecular weight of 153.18 g/mol. Its IUPAC name is 2-amino-1-[(2R)-2-isocyanopyrrolidin-1-yl]ethanone.
| Compound Name | 2-amino-1-[(2R)-2-isocyanopyrrolidin-1-yl]ethanone |
|---|---|
| PubChem CID | 59151521 |
| Molecular Formula | C7H11N3O |
| Molecular Weight | 153.18 g/mol |
| Exact Mass | 153.09 |
| IUPAC Name | 2-amino-1-[(2R)-2-isocyanopyrrolidin-1-yl]ethanone |
| SMILES | [C-]#[N+][C@@H]1CCCN1C(=O)CN |
| InChI | InChI=1S/C7H11N3O/c1-9-6-3-2-4-10(6)7(11)5-8/h6H,2-5,8H2/t6-/m0/s1 |
| InChIKey | SXQSVPKAPZJVNM-LURJTMIESA-N |
| XLogP | -0.19 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.18 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|