C12H21NO3 — CID 137383412
prop-2-enyl (2R,3R)-3-hydroxy-2-methyl-3-(1-methylpyrrolidin-2-yl)propanoate (PubChem CID 137383412) has the molecular formula C12H21NO3 and a molecular weight of 227.30 g/mol. Its IUPAC name is prop-2-enyl (2R,3R)-3-hydroxy-2-methyl-3-(1-methylpyrrolidin-2-yl)propanoate.
| Compound Name | prop-2-enyl (2R,3R)-3-hydroxy-2-methyl-3-(1-methylpyrrolidin-2-yl)propanoate |
|---|---|
| PubChem CID | 137383412 |
| Molecular Formula | C12H21NO3 |
| Molecular Weight | 227.30 g/mol |
| Exact Mass | 227.15 |
| IUPAC Name | prop-2-enyl (2R,3R)-3-hydroxy-2-methyl-3-(1-methylpyrrolidin-2-yl)propanoate |
| SMILES | C=CCOC(=O)[C@H](C)[C@@H](O)C1CCCN1C |
| InChI | InChI=1S/C12H21NO3/c1-4-8-16-12(15)9(2)11(14)10-6-5-7-13(10)3/h4,9-11,14H,1,5-8H2,2-3H3/t9-,10?,11-/m1/s1 |
| InChIKey | BVUBRIXZNGQTQQ-GLYLRITDSA-N |
| XLogP | 0.81 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.30 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|