C10H17N — CID 130241849
1-methyl-2-penta-3,4-dien-2-ylpyrrolidine (PubChem CID 130241849) has the molecular formula C10H17N and a molecular weight of 151.25 g/mol. Its IUPAC name is 1-methyl-2-penta-3,4-dien-2-ylpyrrolidine.
| Compound Name | 1-methyl-2-penta-3,4-dien-2-ylpyrrolidine |
|---|---|
| PubChem CID | 130241849 |
| Molecular Formula | C10H17N |
| Molecular Weight | 151.25 g/mol |
| Exact Mass | 151.14 |
| IUPAC Name | 1-methyl-2-penta-3,4-dien-2-ylpyrrolidine |
| SMILES | C=C=CC(C)C1CCCN1C |
| InChI | InChI=1S/C10H17N/c1-4-6-9(2)10-7-5-8-11(10)3/h6,9-10H,1,5,7-8H2,2-3H3 |
| InChIKey | NUGGIVSARDTJOT-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.25 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |