C9H15N — CID 134716119
1-methyl-2-propa-1,2-dienylpiperidine (PubChem CID 134716119) has the molecular formula C9H15N and a molecular weight of 137.23 g/mol. Its IUPAC name is 1-methyl-2-propa-1,2-dienylpiperidine.
| Compound Name | 1-methyl-2-propa-1,2-dienylpiperidine |
|---|---|
| PubChem CID | 134716119 |
| Molecular Formula | C9H15N |
| Molecular Weight | 137.23 g/mol |
| Exact Mass | 137.12 |
| IUPAC Name | 1-methyl-2-propa-1,2-dienylpiperidine |
| SMILES | C=C=CC1CCCCN1C |
| InChI | InChI=1S/C9H15N/c1-3-6-9-7-4-5-8-10(9)2/h6,9H,1,4-5,7-8H2,2H3 |
| InChIKey | BZWSKJFHESQOQQ-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.23 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |