C9H18NO2+ — CID 101156252
3-(1,1-dimethylpyrrolidin-1-ium-2-yl)propanoic acid (PubChem CID 101156252) has the molecular formula C9H18NO2+ and a molecular weight of 172.25 g/mol. Its IUPAC name is 3-(1,1-dimethylpyrrolidin-1-ium-2-yl)propanoic acid.
| Compound Name | 3-(1,1-dimethylpyrrolidin-1-ium-2-yl)propanoic acid |
|---|---|
| PubChem CID | 101156252 |
| Molecular Formula | C9H18NO2+ |
| Molecular Weight | 172.25 g/mol |
| Exact Mass | 172.13 |
| IUPAC Name | 3-(1,1-dimethylpyrrolidin-1-ium-2-yl)propanoic acid |
| SMILES | C[N+]1(C)CCCC1CCC(=O)O |
| InChI | InChI=1S/C9H17NO2/c1-10(2)7-3-4-8(10)5-6-9(11)12/h8H,3-7H2,1-2H3/p+1 |
| InChIKey | TYRZDBWYCILPET-UHFFFAOYSA-O |
| XLogP | 1.09 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.25 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|