About butanedioic acid;cyclobutane
butanedioic acid;cyclobutane (PubChem CID 157277656) has the molecular formula C8H14O4
and a molecular weight of 174.20 g/mol. Its IUPAC name is butanedioic acid;cyclobutane.
Molecular Properties
| Compound Name | butanedioic acid;cyclobutane |
| PubChem CID | 157277656 |
| Molecular Formula | C8H14O4 |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.09 |
| IUPAC Name | butanedioic acid;cyclobutane |
| SMILES | C1CCC1.O=C(O)CCC(=O)O |
| InChI | InChI=1S/C4H6O4.C4H8/c5-3(6)1-2-4(7)8;1-2-4-3-1/h1-2H2,(H,5,6)(H,7,8);1-4H2 |
| InChIKey | AZHGJQSAYRNLKY-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze butanedioic acid;cyclobutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butanedioic acid;cyclobutane?
The IUPAC name of butanedioic acid;cyclobutane (CID 157277656) is butanedioic acid;cyclobutane.
What is the SMILES notation for butanedioic acid;cyclobutane?
The canonical SMILES for butanedioic acid;cyclobutane is C1CCC1.O=C(O)CCC(=O)O.
What is the InChIKey of butanedioic acid;cyclobutane?
The InChIKey is AZHGJQSAYRNLKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6O4.C4H8/c5-3(6)1-2-4(7)8;1-2-4-3-1/h1-2H2,(H,5,6)(H,7,8);1-4H2.
What are the key properties of butanedioic acid;cyclobutane?
butanedioic acid;cyclobutane has a molecular weight of 174.20 g/mol, XLogP of 1.50, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for butanedioic acid;cyclobutane is sourced from PubChem (CID 157277656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).