(2S)-1,1-dimethylpiperidin-1-ium-2-carboxylic acid

C8H16NO2+ — CID 5281111

IUPAC(2S)-1,1-dimethylpiperidin-1-ium-2-carboxylic acid
SMILESC[N+]1(C)CCCC[C@H]1C(=O)O
InChIInChI=1S/C8H15NO2/c1-9(2)6-4-3-5-7(9)8(10)11/h7H,3-6H2,1-2H3/p+1/t7-/m0/s1
InChIKeyXULZWQRXYTVUTE-ZETCQYMHSA-O
MW158.22 g/mol
LogP0.70
Rot. Bonds1

About (2S)-1,1-dimethylpiperidin-1-ium-2-carboxylic acid

(2S)-1,1-dimethylpiperidin-1-ium-2-carboxylic acid (PubChem CID 5281111) has the molecular formula C8H16NO2+ and a molecular weight of 158.22 g/mol. Its IUPAC name is (2S)-1,1-dimethylpiperidin-1-ium-2-carboxylic acid.

Molecular Properties

Compound Name(2S)-1,1-dimethylpiperidin-1-ium-2-carboxylic acid
PubChem CID5281111
Molecular FormulaC8H16NO2+
Molecular Weight158.22 g/mol
Exact Mass158.12
IUPAC Name(2S)-1,1-dimethylpiperidin-1-ium-2-carboxylic acid
SMILESC[N+]1(C)CCCC[C@H]1C(=O)O
InChIInChI=1S/C8H15NO2/c1-9(2)6-4-3-5-7(9)8(10)11/h7H,3-6H2,1-2H3/p+1/t7-/m0/s1
InChIKeyXULZWQRXYTVUTE-ZETCQYMHSA-O
XLogP0.70
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds1
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500158.22
LogP ≤ 50.70
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}

Analyze (2S)-1,1-dimethylpiperidin-1-ium-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2S)-1,1-dimethylpiperidin-1-ium-2-carboxylic acid?
The IUPAC name of (2S)-1,1-dimethylpiperidin-1-ium-2-carboxylic acid (CID 5281111) is (2S)-1,1-dimethylpiperidin-1-ium-2-carboxylic acid.
What is the SMILES notation for (2S)-1,1-dimethylpiperidin-1-ium-2-carboxylic acid?
The canonical SMILES for (2S)-1,1-dimethylpiperidin-1-ium-2-carboxylic acid is C[N+]1(C)CCCC[C@H]1C(=O)O.
What is the InChIKey of (2S)-1,1-dimethylpiperidin-1-ium-2-carboxylic acid?
The InChIKey is XULZWQRXYTVUTE-ZETCQYMHSA-O. The full InChI is InChI=1S/C8H15NO2/c1-9(2)6-4-3-5-7(9)8(10)11/h7H,3-6H2,1-2H3/p+1/t7-/m0/s1.
What are the key properties of (2S)-1,1-dimethylpiperidin-1-ium-2-carboxylic acid?
(2S)-1,1-dimethylpiperidin-1-ium-2-carboxylic acid has a molecular weight of 158.22 g/mol, XLogP of 0.70, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-1,1-dimethylpiperidin-1-ium-2-carboxylic acid is sourced from PubChem (CID 5281111), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).