C8H16NO2+ — CID 5281111
(2S)-1,1-dimethylpiperidin-1-ium-2-carboxylic acid (PubChem CID 5281111) has the molecular formula C8H16NO2+ and a molecular weight of 158.22 g/mol. Its IUPAC name is (2S)-1,1-dimethylpiperidin-1-ium-2-carboxylic acid.
| Compound Name | (2S)-1,1-dimethylpiperidin-1-ium-2-carboxylic acid |
|---|---|
| PubChem CID | 5281111 |
| Molecular Formula | C8H16NO2+ |
| Molecular Weight | 158.22 g/mol |
| Exact Mass | 158.12 |
| IUPAC Name | (2S)-1,1-dimethylpiperidin-1-ium-2-carboxylic acid |
| SMILES | C[N+]1(C)CCCC[C@H]1C(=O)O |
| InChI | InChI=1S/C8H15NO2/c1-9(2)6-4-3-5-7(9)8(10)11/h7H,3-6H2,1-2H3/p+1/t7-/m0/s1 |
| InChIKey | XULZWQRXYTVUTE-ZETCQYMHSA-O |
| XLogP | 0.70 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.22 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|