C7H14NO3+ — CID 546923
4-hydroxy-1,1-dimethylpyrrolidin-1-ium-2-carboxylic acid (PubChem CID 546923) has the molecular formula C7H14NO3+ and a molecular weight of 160.19 g/mol. Its IUPAC name is 4-hydroxy-1,1-dimethylpyrrolidin-1-ium-2-carboxylic acid.
| Compound Name | 4-hydroxy-1,1-dimethylpyrrolidin-1-ium-2-carboxylic acid |
|---|---|
| PubChem CID | 546923 |
| Molecular Formula | C7H14NO3+ |
| Molecular Weight | 160.19 g/mol |
| Exact Mass | 160.10 |
| IUPAC Name | 4-hydroxy-1,1-dimethylpyrrolidin-1-ium-2-carboxylic acid |
| SMILES | C[N+]1(C)CC(O)CC1C(=O)O |
| InChI | InChI=1S/C7H13NO3/c1-8(2)4-5(9)3-6(8)7(10)11/h5-6,9H,3-4H2,1-2H3/p+1 |
| InChIKey | MUNWAHDYFVYIKH-UHFFFAOYSA-O |
| XLogP | -0.72 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.19 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|