C21H24NO+ — CID 163880136
1-(1-benzyl-1-cyclobutyl-2,3-dihydroindol-1-ium-3-yl)ethanone (PubChem CID 163880136) has the molecular formula C21H24NO+ and a molecular weight of 306.43 g/mol. Its IUPAC name is 1-(1-benzyl-1-cyclobutyl-2,3-dihydroindol-1-ium-3-yl)ethanone.
| Compound Name | 1-(1-benzyl-1-cyclobutyl-2,3-dihydroindol-1-ium-3-yl)ethanone |
|---|---|
| PubChem CID | 163880136 |
| Molecular Formula | C21H24NO+ |
| Molecular Weight | 306.43 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | 1-(1-benzyl-1-cyclobutyl-2,3-dihydroindol-1-ium-3-yl)ethanone |
| SMILES | CC(=O)C1C[N+](Cc2ccccc2)(C2CCC2)c2ccccc21 |
| InChI | InChI=1S/C21H24NO/c1-16(23)20-15-22(18-10-7-11-18,14-17-8-3-2-4-9-17)21-13-6-5-12-19(20)21/h2-6,8-9,12-13,18,20H,7,10-11,14-15H2,1H3/q+1 |
| InChIKey | YKYHUUQEOALPFV-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.43 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|