C13H19NO2 — CID 100915975
(1S,3S,6R)-1-benzyl-6-methyl-1-oxidopiperidin-1-ium-3-ol (PubChem CID 100915975) has the molecular formula C13H19NO2 and a molecular weight of 221.30 g/mol. Its IUPAC name is (1S,3S,6R)-1-benzyl-6-methyl-1-oxidopiperidin-1-ium-3-ol.
| Compound Name | (1S,3S,6R)-1-benzyl-6-methyl-1-oxidopiperidin-1-ium-3-ol |
|---|---|
| PubChem CID | 100915975 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | (1S,3S,6R)-1-benzyl-6-methyl-1-oxidopiperidin-1-ium-3-ol |
| SMILES | C[C@@H]1CC[C@H](O)C[N@@+]1([O-])Cc1ccccc1 |
| InChI | InChI=1S/C13H19NO2/c1-11-7-8-13(15)10-14(11,16)9-12-5-3-2-4-6-12/h2-6,11,13,15H,7-10H2,1H3/t11-,13+,14+/m1/s1 |
| InChIKey | CLNDUBRNQXEGHQ-XBFCOCLRSA-N |
| XLogP | 2.04 |
| TPSA | 43.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|