C15H22NO+ — CID 98140534
(1R,5R)-8-benzyl-8-methyl-8-azoniabicyclo[3.2.1]octan-3-ol (PubChem CID 98140534) has the molecular formula C15H22NO+ and a molecular weight of 232.35 g/mol. Its IUPAC name is (1R,5R)-8-benzyl-8-methyl-8-azoniabicyclo[3.2.1]octan-3-ol.
| Compound Name | (1R,5R)-8-benzyl-8-methyl-8-azoniabicyclo[3.2.1]octan-3-ol |
|---|---|
| PubChem CID | 98140534 |
| Molecular Formula | C15H22NO+ |
| Molecular Weight | 232.35 g/mol |
| Exact Mass | 232.17 |
| IUPAC Name | (1R,5R)-8-benzyl-8-methyl-8-azoniabicyclo[3.2.1]octan-3-ol |
| SMILES | C[N+]1(Cc2ccccc2)[C@@H]2CC[C@@H]1CC(O)C2 |
| InChI | InChI=1S/C15H22NO/c1-16(11-12-5-3-2-4-6-12)13-7-8-14(16)10-15(17)9-13/h2-6,13-15,17H,7-11H2,1H3/q+1/t13-,14-,15?,16?/m1/s1 |
| InChIKey | BSGSJFKWCAYJRL-WXLSXGNJSA-N |
| XLogP | 2.32 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.35 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|