C34H48N4O2+2 — CID 11285495
1,6-bis[(1S,5R)-8-benzyl-8-methyl-3-aza-8-azoniabicyclo[3.2.1]octan-3-yl]hexane-1,6-dione (PubChem CID 11285495) has the molecular formula C34H48N4O2+2 and a molecular weight of 544.78 g/mol. Its IUPAC name is 1,6-bis[(1S,5R)-8-benzyl-8-methyl-3-aza-8-azoniabicyclo[3.2.1]octan-3-yl]hexane-1,6-dione.
| Compound Name | 1,6-bis[(1S,5R)-8-benzyl-8-methyl-3-aza-8-azoniabicyclo[3.2.1]octan-3-yl]hexane-1,6-dione |
|---|---|
| PubChem CID | 11285495 |
| Molecular Formula | C34H48N4O2+2 |
| Molecular Weight | 544.78 g/mol |
| Exact Mass | 544.38 |
| IUPAC Name | 1,6-bis[(1S,5R)-8-benzyl-8-methyl-3-aza-8-azoniabicyclo[3.2.1]octan-3-yl]hexane-1,6-dione |
| SMILES | C[N+]1(Cc2ccccc2)[C@@H]2CC[C@H]1CN(C(=O)CCCCC(=O)N1C[C@H]3CC[C@@H](C1)[N+]3(C)Cc1ccccc1)C2 |
| InChI | InChI=1S/C34H48N4O2/c1-37(25-27-11-5-3-6-12-27)29-17-18-30(37)22-35(21-29)33(39)15-9-10-16-34(40)36-23-31-19-20-32(24-36)38(31,2)26-28-13-7-4-8-14-28/h3-8,11-14,29-32H,9-10,15-26H2,1-2H3/q+2/t29-,30+,31-,32+,37?,38? |
| InChIKey | DZMNUILQQODYAC-APCRZUTJSA-N |
| XLogP | 4.59 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.78 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|