C23H37N2O+ — CID 24944905
1-(4-benzyl-4-methylpiperazin-4-ium-1-yl)undec-10-en-1-one (PubChem CID 24944905) has the molecular formula C23H37N2O+ and a molecular weight of 357.56 g/mol. Its IUPAC name is 1-(4-benzyl-4-methylpiperazin-4-ium-1-yl)undec-10-en-1-one.
| Compound Name | 1-(4-benzyl-4-methylpiperazin-4-ium-1-yl)undec-10-en-1-one |
|---|---|
| PubChem CID | 24944905 |
| Molecular Formula | C23H37N2O+ |
| Molecular Weight | 357.56 g/mol |
| Exact Mass | 357.29 |
| IUPAC Name | 1-(4-benzyl-4-methylpiperazin-4-ium-1-yl)undec-10-en-1-one |
| SMILES | C=CCCCCCCCCC(=O)N1CC[N+](C)(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C23H37N2O/c1-3-4-5-6-7-8-9-13-16-23(26)24-17-19-25(2,20-18-24)21-22-14-11-10-12-15-22/h3,10-12,14-15H,1,4-9,13,16-21H2,2H3/q+1 |
| InChIKey | AGNNWOJMZYVWFF-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.56 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|