C18H24NO3+ — CID 87762454
3-benzyl-3-oct-7-enoyl-1,3-oxazolidin-3-ium-2-one (PubChem CID 87762454) has the molecular formula C18H24NO3+ and a molecular weight of 302.39 g/mol. Its IUPAC name is 3-benzyl-3-oct-7-enoyl-1,3-oxazolidin-3-ium-2-one.
| Compound Name | 3-benzyl-3-oct-7-enoyl-1,3-oxazolidin-3-ium-2-one |
|---|---|
| PubChem CID | 87762454 |
| Molecular Formula | C18H24NO3+ |
| Molecular Weight | 302.39 g/mol |
| Exact Mass | 302.18 |
| IUPAC Name | 3-benzyl-3-oct-7-enoyl-1,3-oxazolidin-3-ium-2-one |
| SMILES | C=CCCCCCC(=O)[N+]1(Cc2ccccc2)CCOC1=O |
| InChI | InChI=1S/C18H24NO3/c1-2-3-4-5-9-12-17(20)19(13-14-22-18(19)21)15-16-10-7-6-8-11-16/h2,6-8,10-11H,1,3-5,9,12-15H2/q+1 |
| InChIKey | DJFOGYOFORKYII-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.39 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|