C20H31NO2 — CID 90830081
3-phenyl-2-(undec-10-enylamino)propanoic acid (PubChem CID 90830081) has the molecular formula C20H31NO2 and a molecular weight of 317.47 g/mol. Its IUPAC name is 3-phenyl-2-(undec-10-enylamino)propanoic acid.
| Compound Name | 3-phenyl-2-(undec-10-enylamino)propanoic acid |
|---|---|
| PubChem CID | 90830081 |
| Molecular Formula | C20H31NO2 |
| Molecular Weight | 317.47 g/mol |
| Exact Mass | 317.24 |
| IUPAC Name | 3-phenyl-2-(undec-10-enylamino)propanoic acid |
| SMILES | C=CCCCCCCCCCNC(Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C20H31NO2/c1-2-3-4-5-6-7-8-9-13-16-21-19(20(22)23)17-18-14-11-10-12-15-18/h2,10-12,14-15,19,21H,1,3-9,13,16-17H2,(H,22,23) |
| InChIKey | LOCWWPRKTDFJTD-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.47 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|