C24H39NO5 — CID 91168859
2,3,4-trihydroxybutyl 3-phenyl-2-(undec-10-enylamino)propanoate (PubChem CID 91168859) has the molecular formula C24H39NO5 and a molecular weight of 421.58 g/mol. Its IUPAC name is 2,3,4-trihydroxybutyl 3-phenyl-2-(undec-10-enylamino)propanoate.
| Compound Name | 2,3,4-trihydroxybutyl 3-phenyl-2-(undec-10-enylamino)propanoate |
|---|---|
| PubChem CID | 91168859 |
| Molecular Formula | C24H39NO5 |
| Molecular Weight | 421.58 g/mol |
| Exact Mass | 421.28 |
| IUPAC Name | 2,3,4-trihydroxybutyl 3-phenyl-2-(undec-10-enylamino)propanoate |
| SMILES | C=CCCCCCCCCCNC(Cc1ccccc1)C(=O)OCC(O)C(O)CO |
| InChI | InChI=1S/C24H39NO5/c1-2-3-4-5-6-7-8-9-13-16-25-21(17-20-14-11-10-12-15-20)24(29)30-19-23(28)22(27)18-26/h2,10-12,14-15,21-23,25-28H,1,3-9,13,16-19H2 |
| InChIKey | OOYVKSOWUMLKMM-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 99.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.58 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|