C12H17NO2S — CID 67703263
(2S)-2-(ethylsulfanylmethylamino)-3-phenylpropanoic acid (PubChem CID 67703263) has the molecular formula C12H17NO2S and a molecular weight of 239.34 g/mol. Its IUPAC name is (2S)-2-(ethylsulfanylmethylamino)-3-phenylpropanoic acid.
| Compound Name | (2S)-2-(ethylsulfanylmethylamino)-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 67703263 |
| Molecular Formula | C12H17NO2S |
| Molecular Weight | 239.34 g/mol |
| Exact Mass | 239.10 |
| IUPAC Name | (2S)-2-(ethylsulfanylmethylamino)-3-phenylpropanoic acid |
| SMILES | CCSCN[C@@H](Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C12H17NO2S/c1-2-16-9-13-11(12(14)15)8-10-6-4-3-5-7-10/h3-7,11,13H,2,8-9H2,1H3,(H,14,15)/t11-/m0/s1 |
| InChIKey | NLJDJIOQQAHICV-NSHDSACASA-N |
| XLogP | 1.98 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.34 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|