C15H23NO — CID 71090567
(1S,2R,3R)-5-amino-2-methyl-3-(2-phenylethyl)cyclohexan-1-ol (PubChem CID 71090567) has the molecular formula C15H23NO and a molecular weight of 233.36 g/mol. Its IUPAC name is (1S,2R,3R)-5-amino-2-methyl-3-(2-phenylethyl)cyclohexan-1-ol.
| Compound Name | (1S,2R,3R)-5-amino-2-methyl-3-(2-phenylethyl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 71090567 |
| Molecular Formula | C15H23NO |
| Molecular Weight | 233.36 g/mol |
| Exact Mass | 233.18 |
| IUPAC Name | (1S,2R,3R)-5-amino-2-methyl-3-(2-phenylethyl)cyclohexan-1-ol |
| SMILES | C[C@@H]1[C@H](CCc2ccccc2)CC(N)C[C@@H]1O |
| InChI | InChI=1S/C15H23NO/c1-11-13(9-14(16)10-15(11)17)8-7-12-5-3-2-4-6-12/h2-6,11,13-15,17H,7-10,16H2,1H3/t11-,13-,14?,15+/m1/s1 |
| InChIKey | FTVBHPDYBPQVST-IBEYCOPNSA-N |
| XLogP | 2.35 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.36 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |