C13H20N2 — CID 80561805
1-N-methyl-1-N-(2-phenylethyl)cyclobutane-1,3-diamine (PubChem CID 80561805) has the molecular formula C13H20N2 and a molecular weight of 204.32 g/mol. Its IUPAC name is 1-N-methyl-1-N-(2-phenylethyl)cyclobutane-1,3-diamine.
| Compound Name | 1-N-methyl-1-N-(2-phenylethyl)cyclobutane-1,3-diamine |
|---|---|
| PubChem CID | 80561805 |
| Molecular Formula | C13H20N2 |
| Molecular Weight | 204.32 g/mol |
| Exact Mass | 204.16 |
| IUPAC Name | 1-N-methyl-1-N-(2-phenylethyl)cyclobutane-1,3-diamine |
| SMILES | CN(CCc1ccccc1)C1CC(N)C1 |
| InChI | InChI=1S/C13H20N2/c1-15(13-9-12(14)10-13)8-7-11-5-3-2-4-6-11/h2-6,12-13H,7-10,14H2,1H3 |
| InChIKey | VBJQMCHMIZTXCB-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.32 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |