C17H22NO6+ — CID 87243858
(3S)-2-benzyl-3-methoxycarbonyl-6,10-dioxa-2-azoniaspiro[4.5]decane-2-carboxylic acid (PubChem CID 87243858) has the molecular formula C17H22NO6+ and a molecular weight of 336.36 g/mol. Its IUPAC name is (3S)-2-benzyl-3-methoxycarbonyl-6,10-dioxa-2-azoniaspiro[4.5]decane-2-carboxylic acid.
| Compound Name | (3S)-2-benzyl-3-methoxycarbonyl-6,10-dioxa-2-azoniaspiro[4.5]decane-2-carboxylic acid |
|---|---|
| PubChem CID | 87243858 |
| Molecular Formula | C17H22NO6+ |
| Molecular Weight | 336.36 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | (3S)-2-benzyl-3-methoxycarbonyl-6,10-dioxa-2-azoniaspiro[4.5]decane-2-carboxylic acid |
| SMILES | COC(=O)[C@@H]1CC2(C[N+]1(Cc1ccccc1)C(=O)O)OCCCO2 |
| InChI | InChI=1S/C17H21NO6/c1-22-15(19)14-10-17(23-8-5-9-24-17)12-18(14,16(20)21)11-13-6-3-2-4-7-13/h2-4,6-7,14H,5,8-12H2,1H3/p+1/t14-,18?/m0/s1 |
| InChIKey | WRLXETBVIYCTBN-PIVQAISJSA-O |
| XLogP | 1.76 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.36 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|