C14H17N2O5+ — CID 87270316
1-benzyl-5-methoxycarbonyl-3-methyl-2-oxoimidazolidin-1-ium-1-carboxylic acid (PubChem CID 87270316) has the molecular formula C14H17N2O5+ and a molecular weight of 293.30 g/mol. Its IUPAC name is 1-benzyl-5-methoxycarbonyl-3-methyl-2-oxoimidazolidin-1-ium-1-carboxylic acid.
| Compound Name | 1-benzyl-5-methoxycarbonyl-3-methyl-2-oxoimidazolidin-1-ium-1-carboxylic acid |
|---|---|
| PubChem CID | 87270316 |
| Molecular Formula | C14H17N2O5+ |
| Molecular Weight | 293.30 g/mol |
| Exact Mass | 293.11 |
| IUPAC Name | 1-benzyl-5-methoxycarbonyl-3-methyl-2-oxoimidazolidin-1-ium-1-carboxylic acid |
| SMILES | COC(=O)C1CN(C)C(=O)[N+]1(Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C14H16N2O5/c1-15-8-11(12(17)21-2)16(13(15)18,14(19)20)9-10-6-4-3-5-7-10/h3-7,11H,8-9H2,1-2H3/p+1 |
| InChIKey | CKZMQDOUFWLMFS-UHFFFAOYSA-O |
| XLogP | 1.29 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.30 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|