C15H20O2S — CID 11651860
cis-methyl (1R,2R)-2-benzylsulfanylcyclohexane-1-carboxylate (PubChem CID 11651860) has the molecular formula C15H20O2S and a molecular weight of 264.39 g/mol. Its IUPAC name is cis-methyl (1R,2R)-2-benzylsulfanylcyclohexane-1-carboxylate.
| Compound Name | cis-methyl (1R,2R)-2-benzylsulfanylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 11651860 |
| Molecular Formula | C15H20O2S |
| Molecular Weight | 264.39 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | cis-methyl (1R,2R)-2-benzylsulfanylcyclohexane-1-carboxylate |
| SMILES | COC(=O)[C@H]1CCCC[C@H]1SCc1ccccc1 |
| InChI | InChI=1S/C15H20O2S/c1-17-15(16)13-9-5-6-10-14(13)18-11-12-7-3-2-4-8-12/h2-4,7-8,13-14H,5-6,9-11H2,1H3/t13-,14+/m0/s1 |
| InChIKey | IIAYUZFEGVWNGR-UONOGXRCSA-N |
| XLogP | 3.65 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.39 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |