C13H16O2S — CID 56618093
2-benzylsulfanylcyclopentane-1-carboxylic acid (PubChem CID 56618093) has the molecular formula C13H16O2S and a molecular weight of 236.34 g/mol. Its IUPAC name is 2-benzylsulfanylcyclopentane-1-carboxylic acid.
| Compound Name | 2-benzylsulfanylcyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 56618093 |
| Molecular Formula | C13H16O2S |
| Molecular Weight | 236.34 g/mol |
| Exact Mass | 236.09 |
| IUPAC Name | 2-benzylsulfanylcyclopentane-1-carboxylic acid |
| SMILES | O=C(O)C1CCCC1SCc1ccccc1 |
| InChI | InChI=1S/C13H16O2S/c14-13(15)11-7-4-8-12(11)16-9-10-5-2-1-3-6-10/h1-3,5-6,11-12H,4,7-9H2,(H,14,15) |
| InChIKey | MWBCAHILHSECLF-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.34 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |