C15H22NO2+ — CID 14198425
[(2S,3aR)-8-benzyl-3,3a,4,5,6,7-hexahydro-2H-[1,2]oxazolo[2,3-a]pyridin-8-ium-2-yl]methanol (PubChem CID 14198425) has the molecular formula C15H22NO2+ and a molecular weight of 248.35 g/mol. Its IUPAC name is [(2S,3aR)-8-benzyl-3,3a,4,5,6,7-hexahydro-2H-[1,2]oxazolo[2,3-a]pyridin-8-ium-2-yl]methanol.
| Compound Name | [(2S,3aR)-8-benzyl-3,3a,4,5,6,7-hexahydro-2H-[1,2]oxazolo[2,3-a]pyridin-8-ium-2-yl]methanol |
|---|---|
| PubChem CID | 14198425 |
| Molecular Formula | C15H22NO2+ |
| Molecular Weight | 248.35 g/mol |
| Exact Mass | 248.16 |
| IUPAC Name | [(2S,3aR)-8-benzyl-3,3a,4,5,6,7-hexahydro-2H-[1,2]oxazolo[2,3-a]pyridin-8-ium-2-yl]methanol |
| SMILES | OC[C@@H]1C[C@H]2CCCC[N+]2(Cc2ccccc2)O1 |
| InChI | InChI=1S/C15H22NO2/c17-12-15-10-14-8-4-5-9-16(14,18-15)11-13-6-2-1-3-7-13/h1-3,6-7,14-15,17H,4-5,8-12H2/q+1/t14-,15+,16?/m1/s1 |
| InChIKey | RTNPHJYOQAZHEN-YSPPHNQVSA-N |
| XLogP | 2.25 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.35 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|