C24H28NO3S+ — CID 11271799
(1R,2R,9S,10S)-7-benzyl-10-phenylsulfanyl-8,13-dioxa-7-azoniatricyclo[7.5.0.02,7]tetradecan-14-one (PubChem CID 11271799) has the molecular formula C24H28NO3S+ and a molecular weight of 410.56 g/mol. Its IUPAC name is (1R,2R,9S,10S)-7-benzyl-10-phenylsulfanyl-8,13-dioxa-7-azoniatricyclo[7.5.0.02,7]tetradecan-14-one.
| Compound Name | (1R,2R,9S,10S)-7-benzyl-10-phenylsulfanyl-8,13-dioxa-7-azoniatricyclo[7.5.0.02,7]tetradecan-14-one |
|---|---|
| PubChem CID | 11271799 |
| Molecular Formula | C24H28NO3S+ |
| Molecular Weight | 410.56 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | (1R,2R,9S,10S)-7-benzyl-10-phenylsulfanyl-8,13-dioxa-7-azoniatricyclo[7.5.0.02,7]tetradecan-14-one |
| SMILES | O=C1OCC[C@H](Sc2ccccc2)[C@H]2O[N+]3(Cc4ccccc4)CCCC[C@@H]3[C@@H]12 |
| InChI | InChI=1S/C24H28NO3S/c26-24-22-20-13-7-8-15-25(20,17-18-9-3-1-4-10-18)28-23(22)21(14-16-27-24)29-19-11-5-2-6-12-19/h1-6,9-12,20-23H,7-8,13-17H2/q+1/t20-,21+,22-,23-,25?/m1/s1 |
| InChIKey | SGUWNAWCQVXTEN-LUGHBPAASA-N |
| XLogP | 4.59 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.56 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|