C18H24BrNO3 — CID 11485849
(1R,2R,9R)-7-benzyl-8,13-dioxa-7-azoniatricyclo[7.5.0.02,7]tetradecan-14-one bromide (PubChem CID 11485849) has the molecular formula C18H24BrNO3 and a molecular weight of 382.30 g/mol. Its IUPAC name is (1R,2R,9R)-7-benzyl-8,13-dioxa-7-azoniatricyclo[7.5.0.02,7]tetradecan-14-one bromide.
| Compound Name | (1R,2R,9R)-7-benzyl-8,13-dioxa-7-azoniatricyclo[7.5.0.02,7]tetradecan-14-one bromide |
|---|---|
| PubChem CID | 11485849 |
| Molecular Formula | C18H24BrNO3 |
| Molecular Weight | 382.30 g/mol |
| Exact Mass | 381.09 |
| IUPAC Name | (1R,2R,9R)-7-benzyl-8,13-dioxa-7-azoniatricyclo[7.5.0.02,7]tetradecan-14-one bromide |
| SMILES | O=C1OCCC[C@H]2O[N+]3(Cc4ccccc4)CCCC[C@@H]3[C@@H]12.[Br-] |
| InChI | InChI=1S/C18H24NO3.BrH/c20-18-17-15-9-4-5-11-19(15,13-14-7-2-1-3-8-14)22-16(17)10-6-12-21-18;/h1-3,7-8,15-17H,4-6,9-13H2;1H/q+1;/p-1/t15-,16-,17-,19?;/m1./s1 |
| InChIKey | XQBHBPNQUGARIQ-DXRKKBCGSA-M |
| XLogP | -0.17 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.30 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|