C19H15F12NO3 — CID 101139268
ethyl (1R,2R,10bS)-2-fluoro-2-(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentyl)-1,5,6,10b-tetrahydro-[1,2]oxazolo[3,2-a]isoquinoline-1-carboxylate (PubChem CID 101139268) has the molecular formula C19H15F12NO3 and a molecular weight of 533.31 g/mol. Its IUPAC name is ethyl (1R,2R,10bS)-2-fluoro-2-(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentyl)-1,5,6,10b-tetrahydro-[1,2]oxazolo[3,2-a]isoquinoline-1-carboxylate.
| Compound Name | ethyl (1R,2R,10bS)-2-fluoro-2-(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentyl)-1,5,6,10b-tetrahydro-[1,2]oxazolo[3,2-a]isoquinoline-1-carboxylate |
|---|---|
| PubChem CID | 101139268 |
| Molecular Formula | C19H15F12NO3 |
| Molecular Weight | 533.31 g/mol |
| Exact Mass | 533.09 |
| IUPAC Name | ethyl (1R,2R,10bS)-2-fluoro-2-(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentyl)-1,5,6,10b-tetrahydro-[1,2]oxazolo[3,2-a]isoquinoline-1-carboxylate |
| SMILES | CCOC(=O)[C@H]1[C@H]2c3ccccc3CCN2O[C@]1(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C19H15F12NO3/c1-2-34-13(33)11-12-10-6-4-3-5-9(10)7-8-32(12)35-14(11,20)15(21,22)16(23,24)17(25,26)18(27,28)19(29,30)31/h3-6,11-12H,2,7-8H2,1H3/t11-,12-,14+/m1/s1 |
| InChIKey | FNYSUZWEKRTTRH-BZPMIXESSA-N |
| XLogP | 5.48 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.31 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|