C25H29NO4 — CID 162399830
diethyl (2S,10bS)-2-benzyl-3,5,6,10b-tetrahydro-2H-pyrrolo[2,1-a]isoquinoline-1,1-dicarboxylate (PubChem CID 162399830) has the molecular formula C25H29NO4 and a molecular weight of 407.51 g/mol. Its IUPAC name is diethyl (2S,10bS)-2-benzyl-3,5,6,10b-tetrahydro-2H-pyrrolo[2,1-a]isoquinoline-1,1-dicarboxylate.
| Compound Name | diethyl (2S,10bS)-2-benzyl-3,5,6,10b-tetrahydro-2H-pyrrolo[2,1-a]isoquinoline-1,1-dicarboxylate |
|---|---|
| PubChem CID | 162399830 |
| Molecular Formula | C25H29NO4 |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.21 |
| IUPAC Name | diethyl (2S,10bS)-2-benzyl-3,5,6,10b-tetrahydro-2H-pyrrolo[2,1-a]isoquinoline-1,1-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)[C@H](Cc2ccccc2)CN2CCc3ccccc3[C@H]21 |
| InChI | InChI=1S/C25H29NO4/c1-3-29-23(27)25(24(28)30-4-2)20(16-18-10-6-5-7-11-18)17-26-15-14-19-12-8-9-13-21(19)22(25)26/h5-13,20,22H,3-4,14-17H2,1-2H3/t20-,22+/m1/s1 |
| InChIKey | QDOYMXXEIQCSBN-IRLDBZIGSA-N |
| XLogP | 3.57 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|