C18H22FNO4 — CID 162398915
diethyl 8-fluoro-2,3,5,10a-tetrahydro-1H-pyrrolo[1,2-b]isoquinoline-10,10-dicarboxylate (PubChem CID 162398915) has the molecular formula C18H22FNO4 and a molecular weight of 335.38 g/mol. Its IUPAC name is diethyl 8-fluoro-2,3,5,10a-tetrahydro-1H-pyrrolo[1,2-b]isoquinoline-10,10-dicarboxylate.
| Compound Name | diethyl 8-fluoro-2,3,5,10a-tetrahydro-1H-pyrrolo[1,2-b]isoquinoline-10,10-dicarboxylate |
|---|---|
| PubChem CID | 162398915 |
| Molecular Formula | C18H22FNO4 |
| Molecular Weight | 335.38 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | diethyl 8-fluoro-2,3,5,10a-tetrahydro-1H-pyrrolo[1,2-b]isoquinoline-10,10-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)c2cc(F)ccc2CN2CCCC21 |
| InChI | InChI=1S/C18H22FNO4/c1-3-23-16(21)18(17(22)24-4-2)14-10-13(19)8-7-12(14)11-20-9-5-6-15(18)20/h7-8,10,15H,3-6,9,11H2,1-2H3 |
| InChIKey | HDYQACWJZVHTII-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.38 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|