C29H33NO6 — CID 162398917
diethyl (1E)-1-[[2-(2-ethoxy-2-oxoethyl)phenyl]methylidene]-2,3,5,10a-tetrahydropyrrolo[1,2-b]isoquinoline-10,10-dicarboxylate (PubChem CID 162398917) has the molecular formula C29H33NO6 and a molecular weight of 491.58 g/mol. Its IUPAC name is diethyl (1E)-1-[[2-(2-ethoxy-2-oxoethyl)phenyl]methylidene]-2,3,5,10a-tetrahydropyrrolo[1,2-b]isoquinoline-10,10-dicarboxylate.
| Compound Name | diethyl (1E)-1-[[2-(2-ethoxy-2-oxoethyl)phenyl]methylidene]-2,3,5,10a-tetrahydropyrrolo[1,2-b]isoquinoline-10,10-dicarboxylate |
|---|---|
| PubChem CID | 162398917 |
| Molecular Formula | C29H33NO6 |
| Molecular Weight | 491.58 g/mol |
| Exact Mass | 491.23 |
| IUPAC Name | diethyl (1E)-1-[[2-(2-ethoxy-2-oxoethyl)phenyl]methylidene]-2,3,5,10a-tetrahydropyrrolo[1,2-b]isoquinoline-10,10-dicarboxylate |
| SMILES | CCOC(=O)Cc1ccccc1/C=C1\CCN2Cc3ccccc3C(C(=O)OCC)(C(=O)OCC)C12 |
| InChI | InChI=1S/C29H33NO6/c1-4-34-25(31)18-21-12-8-7-11-20(21)17-22-15-16-30-19-23-13-9-10-14-24(23)29(26(22)30,27(32)35-5-2)28(33)36-6-3/h7-14,17,26H,4-6,15-16,18-19H2,1-3H3/b22-17+ |
| InChIKey | UHDLYGRQSMNKFT-OQKWZONESA-N |
| XLogP | 3.83 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.58 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|