C22H23NO4 — CID 135020867
dimethyl (1S,9R)-12-benzyl-12-azatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-11,11-dicarboxylate (PubChem CID 135020867) has the molecular formula C22H23NO4 and a molecular weight of 365.43 g/mol. Its IUPAC name is dimethyl (1S,9R)-12-benzyl-12-azatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-11,11-dicarboxylate.
| Compound Name | dimethyl (1S,9R)-12-benzyl-12-azatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-11,11-dicarboxylate |
|---|---|
| PubChem CID | 135020867 |
| Molecular Formula | C22H23NO4 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | dimethyl (1S,9R)-12-benzyl-12-azatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-11,11-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)C[C@H]2Cc3ccccc3[C@@H]1N2Cc1ccccc1 |
| InChI | InChI=1S/C22H23NO4/c1-26-20(24)22(21(25)27-2)13-17-12-16-10-6-7-11-18(16)19(22)23(17)14-15-8-4-3-5-9-15/h3-11,17,19H,12-14H2,1-2H3/t17-,19+/m1/s1 |
| InChIKey | FAJRISDWZRXJLB-MJGOQNOKSA-N |
| XLogP | 2.89 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|