C23H33NO6 — CID 16759313
dimethyl 2-(3-heptyl-2-methoxycarbonyl-3,4-dihydro-1H-isoquinolin-1-yl)propanedioate (PubChem CID 16759313) has the molecular formula C23H33NO6 and a molecular weight of 419.52 g/mol. Its IUPAC name is dimethyl 2-(3-heptyl-2-methoxycarbonyl-3,4-dihydro-1H-isoquinolin-1-yl)propanedioate.
| Compound Name | dimethyl 2-(3-heptyl-2-methoxycarbonyl-3,4-dihydro-1H-isoquinolin-1-yl)propanedioate |
|---|---|
| PubChem CID | 16759313 |
| Molecular Formula | C23H33NO6 |
| Molecular Weight | 419.52 g/mol |
| Exact Mass | 419.23 |
| IUPAC Name | dimethyl 2-(3-heptyl-2-methoxycarbonyl-3,4-dihydro-1H-isoquinolin-1-yl)propanedioate |
| SMILES | CCCCCCCC1Cc2ccccc2C(C(C(=O)OC)C(=O)OC)N1C(=O)OC |
| InChI | InChI=1S/C23H33NO6/c1-5-6-7-8-9-13-17-15-16-12-10-11-14-18(16)20(24(17)23(27)30-4)19(21(25)28-2)22(26)29-3/h10-12,14,17,19-20H,5-9,13,15H2,1-4H3 |
| InChIKey | CIACMOSMMGZILX-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.52 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|